| dbo:description
|
- minerale (it)
- minéral (fr)
- mineral óxido (es)
- מינרל סיליקטי (iw)
- Siliciumdioxid Mineral (de)
- Silizearen barietate tetragonala (SiO2) (eu)
- silica mineral, polymorph of quartz (en)
- silicijev mineral, polimorf kremena (sl)
|
| dbo:thumbnail
| |
| dbo:wikiPageWikiLink
| |
| dbp:birefringence
| |
| dbp:caption
|
- Cristobalite spherulites formed by devitrification from the obsidian matrix. (en)
|
| dbp:category
| |
| dbp:class
| |
| dbp:color
| |
| dbp:dana
| |
| dbp:diaphaneity
| |
| dbp:fracture
| |
| dbp:gravity
| |
| dbp:habit
|
- Octahedra or spherulites up to several cm in diameter (en)
|
| dbp:imasymbol
| |
| dbp:jmol
|
- O[Si]3O[Si]O[Si]O[Si]O[Si]1O[Si]5O[Si]2O[Si]O[Si]0O[Si]O[Si]O[Si]O[Si]O[Si]O[Si]O5 (en)
|
| dbp:luster
| |
| dbp:mohs
| |
| dbp:name
| |
| dbp:opticalprop
| |
| dbp:pleochroism
| |
| dbp:refractive
|
- nε = 1.484 (en)
- nω = 1.487 (en)
|
| dbp:smiles
|
- O[Si]3O[Si]O[Si]O[Si]O[Si]1O[Si]5O[Si]2O[Si]O[Si]0O[Si]O[Si]O[Si]O[Si]O[Si]O[Si]O5 (en)
|
| dbp:streak
| |
| dbp:strunz
| |
| dbp:symmetry
| |
| dbp:system
| |
| dbp:tenacity
| |
| dbp:twinning
| |
| dbp:unitCell
|
- Z = 4 (en)
- a = 4.9709 Å, (en)
- c = 6.9278 Å; (en)
|
| dbp:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:label
|
- Cristobalite (en)
- كريستوباليت (ar)
- Cristobalita (ca)
- Cristobalit (cs)
- Cristobalita (eu)
- Cristobalit (de)
- Cristobalita (es)
- Cristobalite (fr)
- Cristobalite (it)
- クリストバライト (ja)
- Cristobaliet (nl)
- Cristobalita (pt)
- Krystobalit (pl)
- Кристобаліт (uk)
- Кристобалит (ru)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
