| dbo:alternativeName
|
- Deltasone, Liquid Pred, Orasone, others (en)
|
| dbo:bioavailability
| |
| dbo:casNumber
| |
| dbo:chEBI
| |
| dbo:chEMBL
| |
| dbo:description
|
- chemical compound (en)
- composto chimico (it)
- composto químico (pt)
- cheemesch Verbindung (lb)
- chemická sloučenina (cs)
- chemická zlúčenina (sk)
- chemiese verbinding (af)
- chemische verbinding (nl)
- component quimic (oc)
- compositum chemicum (la)
- compost químic (ca)
- composto químico (gl)
- composé chimique (fr)
- compuesto quimico (an)
- compuestu químicu (ast)
- compus chimic (ro)
- kemia kombinaĵo (eo)
- kemiallinen yhdiste (fi)
- kemisk forbindelse (da)
- kjemisk sambinding (nn)
- komponim kimik (sq)
- konposatu kimiko (eu)
- kimyasal bileşik (tr)
- senyawa kimia (in)
- związek chemiczny (pl)
- ķīmisks savienojums (lv)
- хемиско соединение (mk)
- химическое соединение (ru)
- хімічна сполука (uk)
- քիմիական միացություն (hy)
- תרכובת (iw)
- ترکیب شیمیایی (fa)
- مركب كيميائي (ar)
- کیٖمیٲیی مُرَکَب (ks)
- রাসায়নিক যৌগ (bn)
- രാസസംയുക്തം (ml)
- 부신 피질 호르몬제 (ko)
- Arzneistoff, Glucocorticoid, organische Verbindung (de)
- ଏକ ଯୌଗିକ ରାସାୟନିକ ପଦାର୍ଥ ଓ ଔଷଧ (or)
- corticoesteroide sintético (es)
|
| dbo:drugbank
| |
| dbo:fdaUniiCode
| |
| dbo:kegg
| |
| dbo:medlinePlus
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageExternalLink
| |
| dbo:wikiPageWikiLink
| |
| dbp:atcPrefix
| |
| dbp:atcSuffix
| |
| dbp:bioavailability
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chebi
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:dailymedid
| |
| dbp:displayAuthors
| |
| dbp:drugbank
| |
| dbp:eliminationHalfLife
| |
| dbp:excretion
| |
| dbp:h
| |
| dbp:image
|
- Prednisone-from-xtal-3D-bs-17.png (en)
|
| dbp:imageClass
|
- bg-transparent (en)
- skin-invert-image (en)
|
| dbp:iupacName
| |
| dbp:iupharLigand
| |
| dbp:kegg
|
- 7370.0 (dbd:nicaraguanCórdoba)
|
| dbp:legalAu
| |
| dbp:legalCa
| |
| dbp:legalUs
| |
| dbp:medlineplus
| |
| dbp:metabolism
| |
| dbp:nameListStyle
| |
| dbp:o
| |
| dbp:pregnancyAu
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- O=C[C@@]3CC[C@H]2[C@@H]4CC\C1=C\C\C=C/[C@]1[C@H]4CC[C@@]23C (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- XOFYZVNMUHMLCC-ZPOLXVRWSA-N (en)
|
| dbp:tradename
|
- Deltasone, Liquid Pred, Orasone, others (en)
|
| dbp:unii
| |
| dbp:verifiedfields
| |
| dbp:verifiedrevid
| |
| dbp:wikiPageUsesTemplate
| |
| dct:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:label
|
- Prednisone (en)
- بريدنيزون (ar)
- Prednisona (ca)
- Πρεδνιζόνη (el)
- Prednison (de)
- Prednisona (eu)
- Prednisona (es)
- Prednisone (it)
- Prednisone (fr)
- プレドニゾン (ja)
- Prednison (nl)
- Prednizon (pl)
- Prednisona (pt)
- Преднізон (uk)
- 强的松 (zh)
|
| rdfs:seeAlso
| |
| owl:differentFrom
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:knownFor
of | |
| is dbo:medication
of | |
| is dbo:treatment
of | |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is dbp:knownFor
of | |
| is dbp:medication
of | |
| is dbp:treatment
of | |
| is rdfs:seeAlso
of | |
| is owl:differentFrom
of | |
| is foaf:primaryTopic
of | |
